C15H17BClFN2O6 — CID 163296591
CID 163296591 (PubChem CID 163296591) has the molecular formula C15H17BClFN2O6 and a molecular weight of 386.57 g/mol.
| Compound Name | CID 163296591 |
|---|---|
| PubChem CID | 163296591 |
| Molecular Formula | C15H17BClFN2O6 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | — |
| SMILES | [B]C1(O)CN(CC(=O)O)CC(O)(O)C1CNC(=O)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C15H17BClFN2O6/c16-14(24)6-20(5-12(21)22)7-15(25,26)11(14)4-19-13(23)8-1-9(17)3-10(18)2-8/h1-3,11,24-26H,4-7H2,(H,19,23)(H,21,22) |
| InChIKey | IUUJGMQFZNLLIA-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|