C21H28B5ClFN3O7 — CID 163296581
CID 163296581 (PubChem CID 163296581) has the molecular formula C21H28B5ClFN3O7 and a molecular weight of 542.98 g/mol.
| Compound Name | CID 163296581 |
|---|---|
| PubChem CID | 163296581 |
| Molecular Formula | C21H28B5ClFN3O7 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | — |
| SMILES | CC.[B]C1(O)CN(CC(=O)NC(C)(C([B])([B])O)C([B])(O)O)CC([B])(O)C1CNC(=O)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C19H22B5ClFN3O7.C2H6/c1-15(18(22,23)34,19(24,35)36)28-13(30)6-29-7-16(20,32)12(17(21,33)8-29)5-27-14(31)9-2-10(25)4-11(26)3-9;1-2/h2-4,12,32-36H,5-8H2,1H3,(H,27,31)(H,28,30);1-2H3 |
| InChIKey | ZKBMYKFWOUZRPD-UHFFFAOYSA-N |
| XLogP | -3.45 |
| TPSA | 162.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|