C19H22B5ClFN3O2 — CID 163296589
CID 163296589 (PubChem CID 163296589) has the molecular formula C19H22B5ClFN3O2 and a molecular weight of 432.92 g/mol.
| Compound Name | CID 163296589 |
|---|---|
| PubChem CID | 163296589 |
| Molecular Formula | C19H22B5ClFN3O2 |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | — |
| SMILES | [B]C([B])(NC(=O)c1cc(F)cc(Cl)c1)C1CCN(CC(=O)NC(C)(C)C([B])([B])[B])CC1 |
| InChI | InChI=1S/C19H22B5ClFN3O2/c1-17(2,19(22,23)24)27-15(30)10-29-5-3-12(4-6-29)18(20,21)28-16(31)11-7-13(25)9-14(26)8-11/h7-9,12H,3-6,10H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | ICWWSGAFNOIMJX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|