About CID 174006034
CID 174006034 (PubChem CID 174006034) has the molecular formula C19H22B3ClFN3O12S
and a molecular weight of 603.35 g/mol.
Molecular Properties
| Compound Name | CID 174006034 |
| PubChem CID | 174006034 |
| Molecular Formula | C19H22B3ClFN3O12S |
| Molecular Weight | 603.35 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C(C)(NC(=O)CN1C(O)(O)C(O)(O)C2(CNC(=O)c3cc(F)cc(Cl)c3)SC2(O)C1(O)O)C([B])(O)O |
| InChI | InChI=1S/C19H22B3ClFN3O12S/c1-12(16(20,21)33,17(22,34)35)26-10(28)5-27-18(36,37)14(30,31)13(15(32,40-13)19(27,38)39)6-25-11(29)7-2-8(23)4-9(24)3-7/h2-4,30-39H,5-6H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | SUQMSFNHPGWDKN-UHFFFAOYSA-N |
| XLogP | -6.68 |
| TPSA | 263.74 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 603.35 |
| LogP ≤ 5 | -6.68 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 174006034 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174006034?
The IUPAC name of CID 174006034 (CID 174006034) is not available.
What is the SMILES notation for CID 174006034?
The canonical SMILES for CID 174006034 is [B]C([B])(O)C(C)(NC(=O)CN1C(O)(O)C(O)(O)C2(CNC(=O)c3cc(F)cc(Cl)c3)SC2(O)C1(O)O)C([B])(O)O.
What is the InChIKey of CID 174006034?
The InChIKey is SUQMSFNHPGWDKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22B3ClFN3O12S/c1-12(16(20,21)33,17(22,34)35)26-10(28)5-27-18(36,37)14(30,31)13(15(32,40-13)19(27,38)39)6-25-11(29)7-2-8(23)4-9(24)3-7/h2-4,30-39H,5-6H2,1H3,(H,25,29)(H,26,28).
What are the key properties of CID 174006034?
CID 174006034 has a molecular weight of 603.35 g/mol, XLogP of -6.68, 8 rotatable bonds, 12 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174006034 is sourced from PubChem (CID 174006034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).