C19H22B3ClFN3O12S — CID 174006034
CID 174006034 (PubChem CID 174006034) has the molecular formula C19H22B3ClFN3O12S and a molecular weight of 603.35 g/mol.
| Compound Name | CID 174006034 |
|---|---|
| PubChem CID | 174006034 |
| Molecular Formula | C19H22B3ClFN3O12S |
| Molecular Weight | 603.35 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C(C)(NC(=O)CN1C(O)(O)C(O)(O)C2(CNC(=O)c3cc(F)cc(Cl)c3)SC2(O)C1(O)O)C([B])(O)O |
| InChI | InChI=1S/C19H22B3ClFN3O12S/c1-12(16(20,21)33,17(22,34)35)26-10(28)5-27-18(36,37)14(30,31)13(15(32,40-13)19(27,38)39)6-25-11(29)7-2-8(23)4-9(24)3-7/h2-4,30-39H,5-6H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | SUQMSFNHPGWDKN-UHFFFAOYSA-N |
| XLogP | -6.68 |
| TPSA | 263.74 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.35 |
| LogP ≤ 5 | -6.68 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|