C25H31N3O2S — CID 22514932
N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(3-oxo-1,2-benzothiazol-2-yl)propanamide (PubChem CID 22514932) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(3-oxo-1,2-benzothiazol-2-yl)propanamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(3-oxo-1,2-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 22514932 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(3-oxo-1,2-benzothiazol-2-yl)propanamide |
| SMILES | CC(C(=O)NCCCN1CCC(Cc2ccccc2)CC1)n1sc2ccccc2c1=O |
| InChI | InChI=1S/C25H31N3O2S/c1-19(28-25(30)22-10-5-6-11-23(22)31-28)24(29)26-14-7-15-27-16-12-21(13-17-27)18-20-8-3-2-4-9-20/h2-6,8-11,19,21H,7,12-18H2,1H3,(H,26,29) |
| InChIKey | XBIVFUGIYFOVSH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|