C36H39N3O3 — CID 69192330
benzyl-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]phenyl]carbamic acid (PubChem CID 69192330) has the molecular formula C36H39N3O3 and a molecular weight of 561.73 g/mol. Its IUPAC name is benzyl-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]phenyl]carbamic acid.
| Compound Name | benzyl-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 69192330 |
| Molecular Formula | C36H39N3O3 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | benzyl-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]phenyl]carbamic acid |
| SMILES | O=C(NCCCN1CCC(c2cccc(N(Cc3ccccc3)C(=O)O)c2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39N3O3/c40-35(34(30-14-6-2-7-15-30)31-16-8-3-9-17-31)37-22-11-23-38-24-20-29(21-25-38)32-18-10-19-33(26-32)39(36(41)42)27-28-12-4-1-5-13-28/h1-10,12-19,26,29,34H,11,20-25,27H2,(H,37,40)(H,41,42) |
| InChIKey | SDCRXJMMERHJPI-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|