C31H34F3N3O2 — CID 142926195
N-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-2,4,6-trifluorophenyl]propanamide (PubChem CID 142926195) has the molecular formula C31H34F3N3O2 and a molecular weight of 537.63 g/mol. Its IUPAC name is N-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-2,4,6-trifluorophenyl]propanamide.
| Compound Name | N-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-2,4,6-trifluorophenyl]propanamide |
|---|---|
| PubChem CID | 142926195 |
| Molecular Formula | C31H34F3N3O2 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N-[3-[1-[3-[(2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-2,4,6-trifluorophenyl]propanamide |
| SMILES | CCC(=O)Nc1c(F)cc(F)c(C2CCN(CCCNC(=O)C(c3ccccc3)c3ccccc3)CC2)c1F |
| InChI | InChI=1S/C31H34F3N3O2/c1-2-26(38)36-30-25(33)20-24(32)28(29(30)34)23-14-18-37(19-15-23)17-9-16-35-31(39)27(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-8,10-13,20,23,27H,2,9,14-19H2,1H3,(H,35,39)(H,36,38) |
| InChIKey | POCKJDPUKXJZHJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|