C27H35N3O4S — CID 20905878
N-[2-(4-benzylpiperidin-1-yl)ethyl]-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide (PubChem CID 20905878) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-[2-(4-benzylpiperidin-1-yl)ethyl]-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide.
| Compound Name | N-[2-(4-benzylpiperidin-1-yl)ethyl]-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 20905878 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[2-(4-benzylpiperidin-1-yl)ethyl]-4-methylsulfonyl-2-(3-oxo-1H-isoindol-2-yl)butanamide |
| SMILES | CS(=O)(=O)CCC(C(=O)NCCN1CCC(Cc2ccccc2)CC1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C27H35N3O4S/c1-35(33,34)18-13-25(30-20-23-9-5-6-10-24(23)27(30)32)26(31)28-14-17-29-15-11-22(12-16-29)19-21-7-3-2-4-8-21/h2-10,22,25H,11-20H2,1H3,(H,28,31) |
| InChIKey | UOTRCYVCVWSUGK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |