C27H36N7O5+ — CID 143764964
2-amino-3-[2-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;methoxyazanium (PubChem CID 143764964) has the molecular formula C27H36N7O5+ and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-amino-3-[2-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;methoxyazanium.
| Compound Name | 2-amino-3-[2-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;methoxyazanium |
|---|---|
| PubChem CID | 143764964 |
| Molecular Formula | C27H36N7O5+ |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 2-amino-3-[2-[4-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;methoxyazanium |
| SMILES | CO[NH3+].NC1=C(NCCN2CCN(c3ccc([N+](=O)[O-])c(N4CCCC4)c3)CC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H30N6O4.CH6NO/c27-23-24(26(34)20-6-2-1-5-19(20)25(23)33)28-9-12-29-13-15-30(16-14-29)18-7-8-21(32(35)36)22(17-18)31-10-3-4-11-31;1-3-2/h1-2,5-8,17,28H,3-4,9-16,27H2;1-2H3/q;+1 |
| InChIKey | CQDLWXAKQQBMPH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 161.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|