C27H39FN6O2 — CID 69351649
1-(5-fluoro-2-nitrophenyl)piperidine;4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylaniline (PubChem CID 69351649) has the molecular formula C27H39FN6O2 and a molecular weight of 498.65 g/mol. Its IUPAC name is 1-(5-fluoro-2-nitrophenyl)piperidine;4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylaniline.
| Compound Name | 1-(5-fluoro-2-nitrophenyl)piperidine;4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 69351649 |
| Molecular Formula | C27H39FN6O2 |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 1-(5-fluoro-2-nitrophenyl)piperidine;4-(4-methylpiperazin-1-yl)-2-piperidin-1-ylaniline |
| SMILES | CN1CCN(c2ccc(N)c(N3CCCCC3)c2)CC1.O=[N+]([O-])c1ccc(F)cc1N1CCCCC1 |
| InChI | InChI=1S/C16H26N4.C11H13FN2O2/c1-18-9-11-19(12-10-18)14-5-6-15(17)16(13-14)20-7-3-2-4-8-20;12-9-4-5-10(14(15)16)11(8-9)13-6-2-1-3-7-13/h5-6,13H,2-4,7-12,17H2,1H3;4-5,8H,1-3,6-7H2 |
| InChIKey | ZHUAGKPFMZMJLG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|