C23H27N6O4+ — CID 143764520
2-amino-3-[2-(4-furo[2,3-c]pyridin-7-ylpiperazin-1-yl)ethylamino]naphthalene-1,4-dione;hydroxyazanium (PubChem CID 143764520) has the molecular formula C23H27N6O4+ and a molecular weight of 451.51 g/mol. Its IUPAC name is 2-amino-3-[2-(4-furo[2,3-c]pyridin-7-ylpiperazin-1-yl)ethylamino]naphthalene-1,4-dione;hydroxyazanium.
| Compound Name | 2-amino-3-[2-(4-furo[2,3-c]pyridin-7-ylpiperazin-1-yl)ethylamino]naphthalene-1,4-dione;hydroxyazanium |
|---|---|
| PubChem CID | 143764520 |
| Molecular Formula | C23H27N6O4+ |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-amino-3-[2-(4-furo[2,3-c]pyridin-7-ylpiperazin-1-yl)ethylamino]naphthalene-1,4-dione;hydroxyazanium |
| SMILES | NC1=C(NCCN2CCN(c3nccc4ccoc34)CC2)C(=O)c2ccccc2C1=O.[NH3+]O |
| InChI | InChI=1S/C23H23N5O3.H4NO/c24-18-19(21(30)17-4-2-1-3-16(17)20(18)29)25-8-9-27-10-12-28(13-11-27)23-22-15(5-7-26-23)6-14-31-22;1-2/h1-7,14,25H,8-13,24H2;2H,1H3/q;+1 |
| InChIKey | OMGSUSWJNNNWJF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 152.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|