C17H27N5 — CID 10518421
1-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-4,5-dihydroimidazol-2-amine (PubChem CID 10518421) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is 1-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 10518421 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 1-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-4,5-dihydroimidazol-2-amine |
| SMILES | Cc1ccc(N2CCN(CCCN3CCN=C3N)CC2)cc1 |
| InChI | InChI=1S/C17H27N5/c1-15-3-5-16(6-4-15)21-13-11-20(12-14-21)8-2-9-22-10-7-19-17(22)18/h3-6H,2,7-14H2,1H3,(H2,18,19) |
| InChIKey | ITZOWMXLQUPSSA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|