C25H29FN4O2S — CID 70343994
1-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-3,4,4-trimethyl-2λ6,1,3-benzothiadiazine 2,2-dioxide (PubChem CID 70343994) has the molecular formula C25H29FN4O2S and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-3,4,4-trimethyl-2λ6,1,3-benzothiadiazine 2,2-dioxide.
| Compound Name | 1-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-3,4,4-trimethyl-2λ6,1,3-benzothiadiazine 2,2-dioxide |
|---|---|
| PubChem CID | 70343994 |
| Molecular Formula | C25H29FN4O2S |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 1-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-3,4,4-trimethyl-2λ6,1,3-benzothiadiazine 2,2-dioxide |
| SMILES | CN1C(C)(C)c2ccccc2N(CCN2CC=C(c3c[nH]c4cc(F)ccc34)CC2)S1(=O)=O |
| InChI | InChI=1S/C25H29FN4O2S/c1-25(2)22-6-4-5-7-24(22)30(33(31,32)28(25)3)15-14-29-12-10-18(11-13-29)21-17-27-23-16-19(26)8-9-20(21)23/h4-10,16-17,27H,11-15H2,1-3H3 |
| InChIKey | FYBHPFOWMMICMP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |