C18H25NO2 — CID 154941304
ethyl (2Z)-2-(1-benzyl-2,2-dimethylpiperidin-4-ylidene)acetate (PubChem CID 154941304) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is ethyl (2Z)-2-(1-benzyl-2,2-dimethylpiperidin-4-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(1-benzyl-2,2-dimethylpiperidin-4-ylidene)acetate |
|---|---|
| PubChem CID | 154941304 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | ethyl (2Z)-2-(1-benzyl-2,2-dimethylpiperidin-4-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/CCN(Cc2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C18H25NO2/c1-4-21-17(20)12-16-10-11-19(18(2,3)13-16)14-15-8-6-5-7-9-15/h5-9,12H,4,10-11,13-14H2,1-3H3/b16-12- |
| InChIKey | BWUZANHKSNGQLY-VBKFSLOCSA-N |
| XLogP | 3.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|