C15H25BrN2 — CID 139730663
4-benzyl-1,1-diethylpiperazin-1-ium bromide (PubChem CID 139730663) has the molecular formula C15H25BrN2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 4-benzyl-1,1-diethylpiperazin-1-ium bromide.
| Compound Name | 4-benzyl-1,1-diethylpiperazin-1-ium bromide |
|---|---|
| PubChem CID | 139730663 |
| Molecular Formula | C15H25BrN2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-benzyl-1,1-diethylpiperazin-1-ium bromide |
| SMILES | CC[N+]1(CC)CCN(Cc2ccccc2)CC1.[Br-] |
| InChI | InChI=1S/C15H25N2.BrH/c1-3-17(4-2)12-10-16(11-13-17)14-15-8-6-5-7-9-15;/h5-9H,3-4,10-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MZQLQRKDVYUIQI-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|