About (4-benzylpiperazin-1-yl) hypoiodite
(4-benzylpiperazin-1-yl) hypoiodite (PubChem CID 144778500) has the molecular formula C11H15IN2O
and a molecular weight of 318.16 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl) hypoiodite.
Molecular Properties
| Compound Name | (4-benzylpiperazin-1-yl) hypoiodite |
| PubChem CID | 144778500 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (4-benzylpiperazin-1-yl) hypoiodite |
| SMILES | ION1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C11H15IN2O/c12-15-14-8-6-13(7-9-14)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | QSBAVQUKPQKIRW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-benzylpiperazin-1-yl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylpiperazin-1-yl) hypoiodite?
The IUPAC name of (4-benzylpiperazin-1-yl) hypoiodite (CID 144778500) is (4-benzylpiperazin-1-yl) hypoiodite.
What is the SMILES notation for (4-benzylpiperazin-1-yl) hypoiodite?
The canonical SMILES for (4-benzylpiperazin-1-yl) hypoiodite is ION1CCN(Cc2ccccc2)CC1.
What is the InChIKey of (4-benzylpiperazin-1-yl) hypoiodite?
The InChIKey is QSBAVQUKPQKIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15IN2O/c12-15-14-8-6-13(7-9-14)10-11-4-2-1-3-5-11/h1-5H,6-10H2.
What are the key properties of (4-benzylpiperazin-1-yl) hypoiodite?
(4-benzylpiperazin-1-yl) hypoiodite has a molecular weight of 318.16 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylpiperazin-1-yl) hypoiodite is sourced from PubChem (CID 144778500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).