C12H11FN4 — CID 114253268
2-[(3-amino-5-methylpyrazol-1-yl)methyl]-4-fluorobenzonitrile (PubChem CID 114253268) has the molecular formula C12H11FN4 and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-[(3-amino-5-methylpyrazol-1-yl)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(3-amino-5-methylpyrazol-1-yl)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 114253268 |
| Molecular Formula | C12H11FN4 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-[(3-amino-5-methylpyrazol-1-yl)methyl]-4-fluorobenzonitrile |
| SMILES | Cc1cc(N)nn1Cc1cc(F)ccc1C#N |
| InChI | InChI=1S/C12H11FN4/c1-8-4-12(15)16-17(8)7-10-5-11(13)3-2-9(10)6-14/h2-5H,7H2,1H3,(H2,15,16) |
| InChIKey | UATBQTFIOKGSNK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |