C18H26ClN3O — CID 143316463
1-[(5-chloro-2-methylphenyl)methyl]-5-methylpyrazole-3-carboxamide;2-methylbutane (PubChem CID 143316463) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-[(5-chloro-2-methylphenyl)methyl]-5-methylpyrazole-3-carboxamide;2-methylbutane.
| Compound Name | 1-[(5-chloro-2-methylphenyl)methyl]-5-methylpyrazole-3-carboxamide;2-methylbutane |
|---|---|
| PubChem CID | 143316463 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[(5-chloro-2-methylphenyl)methyl]-5-methylpyrazole-3-carboxamide;2-methylbutane |
| SMILES | CCC(C)C.Cc1ccc(Cl)cc1Cn1nc(C(N)=O)cc1C |
| InChI | InChI=1S/C13H14ClN3O.C5H12/c1-8-3-4-11(14)6-10(8)7-17-9(2)5-12(16-17)13(15)18;1-4-5(2)3/h3-6H,7H2,1-2H3,(H2,15,18);5H,4H2,1-3H3 |
| InChIKey | XAAQHKTXHIUYLI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |