C17H21ClN2O2 — CID 71124177
1-[[5-chloro-2-(3-methylbutyl)phenyl]methyl]-5-methylpyrazole-3-carboxylic acid (PubChem CID 71124177) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-[[5-chloro-2-(3-methylbutyl)phenyl]methyl]-5-methylpyrazole-3-carboxylic acid.
| Compound Name | 1-[[5-chloro-2-(3-methylbutyl)phenyl]methyl]-5-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 71124177 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[[5-chloro-2-(3-methylbutyl)phenyl]methyl]-5-methylpyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nn1Cc1cc(Cl)ccc1CCC(C)C |
| InChI | InChI=1S/C17H21ClN2O2/c1-11(2)4-5-13-6-7-15(18)9-14(13)10-20-12(3)8-16(19-20)17(21)22/h6-9,11H,4-5,10H2,1-3H3,(H,21,22) |
| InChIKey | SPTQPOKZZRAPDS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |