C16H18ClN2NaO3 — CID 23696344
sodium 1-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazole-3-carboxylate (PubChem CID 23696344) has the molecular formula C16H18ClN2NaO3 and a molecular weight of 344.77 g/mol. Its IUPAC name is sodium 1-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazole-3-carboxylate.
| Compound Name | sodium 1-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 23696344 |
| Molecular Formula | C16H18ClN2NaO3 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | sodium 1-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazole-3-carboxylate |
| SMILES | Cc1cc(C(=O)[O-])nn1Cc1cc(Cl)ccc1OCC(C)C.[Na+] |
| InChI | InChI=1S/C16H19ClN2O3.Na/c1-10(2)9-22-15-5-4-13(17)7-12(15)8-19-11(3)6-14(18-19)16(20)21;/h4-7,10H,8-9H2,1-3H3,(H,20,21);/q;+1/p-1 |
| InChIKey | WFSQNYSMILXJKY-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |