C24H25F2N5 — CID 42591952
N-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine (PubChem CID 42591952) has the molecular formula C24H25F2N5 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine.
| Compound Name | N-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 42591952 |
| Molecular Formula | C24H25F2N5 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[[1-(2,4-difluorophenyl)-3-(2-methylphenyl)pyrazol-4-yl]methyl]-2-(3,5-dimethylpyrazol-1-yl)ethanamine |
| SMILES | Cc1cc(C)n(CCNCc2cn(-c3ccc(F)cc3F)nc2-c2ccccc2C)n1 |
| InChI | InChI=1S/C24H25F2N5/c1-16-6-4-5-7-21(16)24-19(14-27-10-11-30-18(3)12-17(2)28-30)15-31(29-24)23-9-8-20(25)13-22(23)26/h4-9,12-13,15,27H,10-11,14H2,1-3H3 |
| InChIKey | UOTIYDYZFOCXGL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|