C22H36N4O3 — CID 45229922
1-(diethylamino)-3-[4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol (PubChem CID 45229922) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-(diethylamino)-3-[4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol.
| Compound Name | 1-(diethylamino)-3-[4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45229922 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 1-(diethylamino)-3-[4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
| SMILES | CCN(CC)CC(O)COc1ccc(CNCCc2c(C)n[nH]c2C)cc1OC |
| InChI | InChI=1S/C22H36N4O3/c1-6-26(7-2)14-19(27)15-29-21-9-8-18(12-22(21)28-5)13-23-11-10-20-16(3)24-25-17(20)4/h8-9,12,19,23,27H,6-7,10-11,13-15H2,1-5H3,(H,24,25) |
| InChIKey | PWMRVSVQLZLMDH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|