C25H37N3O3 — CID 175643732
1-[3-[4-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidine-4-carbonitrile (PubChem CID 175643732) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[3-[4-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidine-4-carbonitrile.
| Compound Name | 1-[3-[4-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 175643732 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | 1-[3-[4-[[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidine-4-carbonitrile |
| SMILES | COc1cc(CN2C[C@H]3CCCC[C@H]3C2)ccc1OCC(O)CN1CCC(C#N)CC1 |
| InChI | InChI=1S/C25H37N3O3/c1-30-25-12-20(14-28-15-21-4-2-3-5-22(21)16-28)6-7-24(25)31-18-23(29)17-27-10-8-19(13-26)9-11-27/h6-7,12,19,21-23,29H,2-5,8-11,14-18H2,1H3/t21-,22+,23? |
| InChIKey | BNZULRIYYNNKRD-AIZNXBIQSA-N |
| XLogP | 3.29 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |