C18H29N3 — CID 134077416
8-butan-2-yl-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decane (PubChem CID 134077416) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 8-butan-2-yl-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-butan-2-yl-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 134077416 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 8-butan-2-yl-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decane |
| SMILES | CCC(C)N1CCC2(CCN(Cc3cccnc3)C2)CC1 |
| InChI | InChI=1S/C18H29N3/c1-3-16(2)21-11-7-18(8-12-21)6-10-20(15-18)14-17-5-4-9-19-13-17/h4-5,9,13,16H,3,6-8,10-12,14-15H2,1-2H3 |
| InChIKey | VEUGOOWSQZKZKK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |