C23H29N3O2 — CID 134071620
1-[7a-phenyl-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-ethoxyethanone (PubChem CID 134071620) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-[7a-phenyl-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-ethoxyethanone.
| Compound Name | 1-[7a-phenyl-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 134071620 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-[7a-phenyl-2-(pyridin-3-ylmethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1CCC2(c3ccccc3)CN(Cc3cccnc3)CC2C1 |
| InChI | InChI=1S/C23H29N3O2/c1-2-28-17-22(27)26-12-10-23(20-8-4-3-5-9-20)18-25(15-21(23)16-26)14-19-7-6-11-24-13-19/h3-9,11,13,21H,2,10,12,14-18H2,1H3 |
| InChIKey | MTMZQYBAFAOXLW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |