C16H31N3 — CID 124876193
(9aR)-2-cyclohexyl-6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine (PubChem CID 124876193) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is (9aR)-2-cyclohexyl-6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine.
| Compound Name | (9aR)-2-cyclohexyl-6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124876193 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (9aR)-2-cyclohexyl-6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazine |
| SMILES | CN1C[C@@H]2CN(C3CCCCC3)CCN2C(C)(C)C1 |
| InChI | InChI=1S/C16H31N3/c1-16(2)13-17(3)11-15-12-18(9-10-19(15)16)14-7-5-4-6-8-14/h14-15H,4-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | MBIZTNAYXGLTLO-OAHLLOKOSA-N |
| XLogP | 2.03 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |