C16H29N3O3S — CID 124874082
[(9aS)-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone (PubChem CID 124874082) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is [(9aS)-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone.
| Compound Name | [(9aS)-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 124874082 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | [(9aS)-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone |
| SMILES | CC1(C)CN(S(C)(=O)=O)C[C@@H]2CN(C(=O)C3CCCC3)CCN21 |
| InChI | InChI=1S/C16H29N3O3S/c1-16(2)12-18(23(3,21)22)11-14-10-17(8-9-19(14)16)15(20)13-6-4-5-7-13/h13-14H,4-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | CNLGDIDIIUDEDS-AWEZNQCLSA-N |
| XLogP | 0.74 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |