C13H19F3N2O5 — CID 140663920
4-O-tert-butyl 1-O-(1,1,1-trifluoro-3-oxopropan-2-yl) piperazine-1,4-dicarboxylate (PubChem CID 140663920) has the molecular formula C13H19F3N2O5 and a molecular weight of 340.30 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(1,1,1-trifluoro-3-oxopropan-2-yl) piperazine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-(1,1,1-trifluoro-3-oxopropan-2-yl) piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 140663920 |
| Molecular Formula | C13H19F3N2O5 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-O-tert-butyl 1-O-(1,1,1-trifluoro-3-oxopropan-2-yl) piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H19F3N2O5/c1-12(2,3)23-11(21)18-6-4-17(5-7-18)10(20)22-9(8-19)13(14,15)16/h8-9H,4-7H2,1-3H3 |
| InChIKey | UQZOYRFGDAQXML-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|