C15H26N2O8 — CID 166937551
tert-butyl 4-[(2R,3S,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]piperazine-1-carboxylate (PubChem CID 166937551) has the molecular formula C15H26N2O8 and a molecular weight of 362.38 g/mol. Its IUPAC name is tert-butyl 4-[(2R,3S,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R,3S,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166937551 |
| Molecular Formula | C15H26N2O8 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl 4-[(2R,3S,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C=O)CC1 |
| InChI | InChI=1S/C15H26N2O8/c1-15(2,3)25-14(24)17-6-4-16(5-7-17)13(23)12(22)11(21)10(20)9(19)8-18/h8-12,19-22H,4-7H2,1-3H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | VXLMWRFWVQMHQS-WISYIIOYSA-N |
| XLogP | -2.29 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|