C13H15N3O4 — CID 63002704
1-(2-acetyl-4-nitrophenyl)-1,4-diazepan-5-one (PubChem CID 63002704) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-(2-acetyl-4-nitrophenyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-acetyl-4-nitrophenyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63002704 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-(2-acetyl-4-nitrophenyl)-1,4-diazepan-5-one |
| SMILES | CC(=O)c1cc([N+](=O)[O-])ccc1N1CCNC(=O)CC1 |
| InChI | InChI=1S/C13H15N3O4/c1-9(17)11-8-10(16(19)20)2-3-12(11)15-6-4-13(18)14-5-7-15/h2-3,8H,4-7H2,1H3,(H,14,18) |
| InChIKey | UWLOABQVGOSXFB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|