C13H17N3O3 — CID 63000471
methyl 5-amino-2-(5-oxo-1,4-diazepan-1-yl)benzoate (PubChem CID 63000471) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl 5-amino-2-(5-oxo-1,4-diazepan-1-yl)benzoate.
| Compound Name | methyl 5-amino-2-(5-oxo-1,4-diazepan-1-yl)benzoate |
|---|---|
| PubChem CID | 63000471 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl 5-amino-2-(5-oxo-1,4-diazepan-1-yl)benzoate |
| SMILES | COC(=O)c1cc(N)ccc1N1CCNC(=O)CC1 |
| InChI | InChI=1S/C13H17N3O3/c1-19-13(18)10-8-9(14)2-3-11(10)16-6-4-12(17)15-5-7-16/h2-3,8H,4-7,14H2,1H3,(H,15,17) |
| InChIKey | ZKYLWQRUMPBPQO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|