C12H16N4O3 — CID 80831405
1-[3-(methylamino)-5-nitrophenyl]-1,4-diazepan-5-one (PubChem CID 80831405) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[3-(methylamino)-5-nitrophenyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(methylamino)-5-nitrophenyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 80831405 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[3-(methylamino)-5-nitrophenyl]-1,4-diazepan-5-one |
| SMILES | CNc1cc(N2CCNC(=O)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N4O3/c1-13-9-6-10(8-11(7-9)16(18)19)15-4-2-12(17)14-3-5-15/h6-8,13H,2-5H2,1H3,(H,14,17) |
| InChIKey | YNTCJPPTFCORBV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|