C10H10F5N3O3S — CID 126667736
4-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]piperazin-2-one (PubChem CID 126667736) has the molecular formula C10H10F5N3O3S and a molecular weight of 347.27 g/mol. Its IUPAC name is 4-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]piperazin-2-one.
| Compound Name | 4-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 126667736 |
| Molecular Formula | C10H10F5N3O3S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 4-[2-nitro-4-(pentafluoro-λ6-sulfanyl)phenyl]piperazin-2-one |
| SMILES | O=C1CN(c2ccc(S(F)(F)(F)(F)F)cc2[N+](=O)[O-])CCN1 |
| InChI | InChI=1S/C10H10F5N3O3S/c11-22(12,13,14,15)7-1-2-8(9(5-7)18(20)21)17-4-3-16-10(19)6-17/h1-2,5H,3-4,6H2,(H,16,19) |
| InChIKey | FERGNMPSXUSMQS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|