C13H21ClN4O3 — CID 44658972
2-[5-(4-methylpiperazin-4-ium-1-yl)-2-nitroanilino]ethanol chloride (PubChem CID 44658972) has the molecular formula C13H21ClN4O3 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-[5-(4-methylpiperazin-4-ium-1-yl)-2-nitroanilino]ethanol chloride.
| Compound Name | 2-[5-(4-methylpiperazin-4-ium-1-yl)-2-nitroanilino]ethanol chloride |
|---|---|
| PubChem CID | 44658972 |
| Molecular Formula | C13H21ClN4O3 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[5-(4-methylpiperazin-4-ium-1-yl)-2-nitroanilino]ethanol chloride |
| SMILES | C[NH+]1CCN(c2ccc([N+](=O)[O-])c(NCCO)c2)CC1.[Cl-] |
| InChI | InChI=1S/C13H20N4O3.ClH/c1-15-5-7-16(8-6-15)11-2-3-13(17(19)20)12(10-11)14-4-9-18;/h2-3,10,14,18H,4-9H2,1H3;1H |
| InChIKey | PEWJRGYAYWQAHX-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|