C18H28N6O2+2 — CID 7319783
N-[(E)-1-azoniabicyclo[2.2.2]octan-3-ylideneamino]-5-(4-methylpiperazin-4-ium-1-yl)-2-nitroaniline (PubChem CID 7319783) has the molecular formula C18H28N6O2+2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(E)-1-azoniabicyclo[2.2.2]octan-3-ylideneamino]-5-(4-methylpiperazin-4-ium-1-yl)-2-nitroaniline.
| Compound Name | N-[(E)-1-azoniabicyclo[2.2.2]octan-3-ylideneamino]-5-(4-methylpiperazin-4-ium-1-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 7319783 |
| Molecular Formula | C18H28N6O2+2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-[(E)-1-azoniabicyclo[2.2.2]octan-3-ylideneamino]-5-(4-methylpiperazin-4-ium-1-yl)-2-nitroaniline |
| SMILES | C[NH+]1CCN(c2ccc([N+](=O)[O-])c(N/N=C3/C[NH+]4CCC3CC4)c2)CC1 |
| InChI | InChI=1S/C18H26N6O2/c1-21-8-10-23(11-9-21)15-2-3-18(24(25)26)16(12-15)19-20-17-13-22-6-4-14(17)5-7-22/h2-3,12,14,19H,4-11,13H2,1H3/p+2/b20-17- |
| InChIKey | ASEUFCBJOVYHRS-JZJYNLBNSA-P |
| XLogP | -0.99 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|