C23H22ClF3N5O2P — CID 175382014
1-[7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 175382014) has the molecular formula C23H22ClF3N5O2P and a molecular weight of 523.88 g/mol. Its IUPAC name is 1-[7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 175382014 |
| Molecular Formula | C23H22ClF3N5O2P |
| Molecular Weight | 523.88 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 1-[7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)NC(C(=O)C(F)(F)F)CC3)ncc1Cl |
| InChI | InChI=1S/C23H22ClF3N5O2P/c1-35(2,34)19-6-4-3-5-16(19)31-21-15(24)12-28-22(32-21)29-14-9-7-13-8-10-17(30-18(13)11-14)20(33)23(25,26)27/h3-7,9,11-12,17,30H,8,10H2,1-2H3,(H2,28,29,31,32) |
| InChIKey | SYKKIRNINGXWHJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.88 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|