C30H39ClN5OP — CID 170014655
2-N-[(7S)-7-[2-(3-aminocyclobutyl)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 170014655) has the molecular formula C30H39ClN5OP and a molecular weight of 552.10 g/mol. Its IUPAC name is 2-N-[(7S)-7-[2-(3-aminocyclobutyl)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(7S)-7-[2-(3-aminocyclobutyl)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 170014655 |
| Molecular Formula | C30H39ClN5OP |
| Molecular Weight | 552.10 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 2-N-[(7S)-7-[2-(3-aminocyclobutyl)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(Nc3ccc4c(c3)CC[C@@H](CCC3CC(N)C3)CC4)ncc2Cl)c(P(C)(C)=O)c1 |
| InChI | InChI=1S/C30H39ClN5OP/c1-19-4-13-27(28(14-19)38(2,3)37)35-29-26(31)18-33-30(36-29)34-25-12-11-22-9-7-20(8-10-23(22)17-25)5-6-21-15-24(32)16-21/h4,11-14,17-18,20-21,24H,5-10,15-16,32H2,1-3H3,(H2,33,34,35,36)/t20-,21?,24?/m0/s1 |
| InChIKey | UUAVHSKBRGLVKA-MFMCRYCZSA-N |
| XLogP | 7.19 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.10 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|