C29H34ClFN5O2P — CID 166872625
5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)-2-N-[(7R)-7-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine (PubChem CID 166872625) has the molecular formula C29H34ClFN5O2P and a molecular weight of 570.05 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)-2-N-[(7R)-7-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)-2-N-[(7R)-7-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166872625 |
| Molecular Formula | C29H34ClFN5O2P |
| Molecular Weight | 570.05 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)-2-N-[(7R)-7-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1cc(F)ccc1Nc1nc(Nc2ccc3c(c2)CC[C@H](N2C4CCC2COC4)CC3)ncc1Cl |
| InChI | InChI=1S/C29H34ClFN5O2P/c1-39(2,37)27-14-20(31)6-12-26(27)34-28-25(30)15-32-29(35-28)33-21-7-3-18-4-8-22(9-5-19(18)13-21)36-23-10-11-24(36)17-38-16-23/h3,6-7,12-15,22-24H,4-5,8-11,16-17H2,1-2H3,(H2,32,33,34,35)/t22-,23?,24?/m1/s1 |
| InChIKey | DZRZDVLLKVQFAT-ZKMFCFPVSA-N |
| XLogP | 6.11 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.05 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|