C28H32Cl2N5O2P — CID 166872515
5-chloro-4-N-(4-chloro-2-dimethylphosphorylphenyl)-2-N-[7-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine (PubChem CID 166872515) has the molecular formula C28H32Cl2N5O2P and a molecular weight of 572.48 g/mol. Its IUPAC name is 5-chloro-4-N-(4-chloro-2-dimethylphosphorylphenyl)-2-N-[7-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(4-chloro-2-dimethylphosphorylphenyl)-2-N-[7-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166872515 |
| Molecular Formula | C28H32Cl2N5O2P |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 5-chloro-4-N-(4-chloro-2-dimethylphosphorylphenyl)-2-N-[7-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1cc(Cl)ccc1Nc1nc(Nc2ccc3c(c2)CCC(N2C[C@H]4C[C@@H]2CO4)CC3)ncc1Cl |
| InChI | InChI=1S/C28H32Cl2N5O2P/c1-38(2,36)26-12-19(29)6-10-25(26)33-27-24(30)14-31-28(34-27)32-20-7-3-17-4-8-21(9-5-18(17)11-20)35-15-23-13-22(35)16-37-23/h3,6-7,10-12,14,21-23H,4-5,8-9,13,15-16H2,1-2H3,(H2,31,32,33,34)/t21?,22-,23-/m1/s1 |
| InChIKey | QVELQJAQCRQAMJ-XMCWYHTOSA-N |
| XLogP | 6.24 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|