C31H37ClN5O2P — CID 168846947
2-N-[(7S)-7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(4-cyclopropyloxy-2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 168846947) has the molecular formula C31H37ClN5O2P and a molecular weight of 578.10 g/mol. Its IUPAC name is 2-N-[(7S)-7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(4-cyclopropyloxy-2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(7S)-7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(4-cyclopropyloxy-2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 168846947 |
| Molecular Formula | C31H37ClN5O2P |
| Molecular Weight | 578.10 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 2-N-[(7S)-7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(4-cyclopropyloxy-2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1cc(OC2CC2)ccc1Nc1nc(Nc2ccc3c(c2)CC[C@@H](N2CC4CC2C4)CC3)ncc1Cl |
| InChI | InChI=1S/C31H37ClN5O2P/c1-40(2,38)29-16-26(39-25-9-10-25)11-12-28(29)35-30-27(32)17-33-31(36-30)34-22-6-3-20-4-7-23(8-5-21(20)15-22)37-18-19-13-24(37)14-19/h3,6,11-12,15-17,19,23-25H,4-5,7-10,13-14,18H2,1-2H3,(H2,33,34,35,36)/t19?,23-,24?/m0/s1 |
| InChIKey | OUXYEXKERRBZSR-JWLIYLPMSA-N |
| XLogP | 6.75 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.10 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|