C28H32ClFN5OP — CID 166872273
2-N-[7-(3-azabicyclo[3.1.0]hexan-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)pyrimidine-2,4-diamine (PubChem CID 166872273) has the molecular formula C28H32ClFN5OP and a molecular weight of 540.02 g/mol. Its IUPAC name is 2-N-[7-(3-azabicyclo[3.1.0]hexan-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[7-(3-azabicyclo[3.1.0]hexan-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166872273 |
| Molecular Formula | C28H32ClFN5OP |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 2-N-[7-(3-azabicyclo[3.1.0]hexan-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-(2-dimethylphosphoryl-4-fluorophenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1cc(F)ccc1Nc1nc(Nc2ccc3c(c2)CCC(N2CC4CC4C2)CC3)ncc1Cl |
| InChI | InChI=1S/C28H32ClFN5OP/c1-37(2,36)26-13-21(30)6-10-25(26)33-27-24(29)14-31-28(34-27)32-22-7-3-17-4-8-23(9-5-18(17)12-22)35-15-19-11-20(19)16-35/h3,6-7,10,12-14,19-20,23H,4-5,8-9,11,15-16H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | OZPDLTHAAOQZHT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|