C29H33ClF2N5O2P — CID 166872943
2-N-[7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-[4-(difluoromethoxy)-2-dimethylphosphorylphenyl]pyrimidine-2,4-diamine (PubChem CID 166872943) has the molecular formula C29H33ClF2N5O2P and a molecular weight of 588.04 g/mol. Its IUPAC name is 2-N-[7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-[4-(difluoromethoxy)-2-dimethylphosphorylphenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-[4-(difluoromethoxy)-2-dimethylphosphorylphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166872943 |
| Molecular Formula | C29H33ClF2N5O2P |
| Molecular Weight | 588.04 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 2-N-[7-(2-azabicyclo[2.1.1]hexan-2-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-5-chloro-4-N-[4-(difluoromethoxy)-2-dimethylphosphorylphenyl]pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1cc(OC(F)F)ccc1Nc1nc(Nc2ccc3c(c2)CCC(N2CC4CC2C4)CC3)ncc1Cl |
| InChI | InChI=1S/C29H33ClF2N5O2P/c1-40(2,38)26-14-23(39-28(31)32)9-10-25(26)35-27-24(30)15-33-29(36-27)34-20-6-3-18-4-7-21(8-5-19(18)13-20)37-16-17-11-22(37)12-17/h3,6,9-10,13-15,17,21-22,28H,4-5,7-8,11-12,16H2,1-2H3,(H2,33,34,35,36) |
| InChIKey | IKEDOXPVZRKCIW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.04 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|