C19H21ClN4 — CID 135252056
(1R)-1-N-[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine (PubChem CID 135252056) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is (1R)-1-N-[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine.
| Compound Name | (1R)-1-N-[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 135252056 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (1R)-1-N-[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]cyclohexane-1,3-diamine |
| SMILES | NC1CCC[C@@H](Nc2ncc(Cl)c(C3=CCc4ccccc43)n2)C1 |
| InChI | InChI=1S/C19H21ClN4/c20-17-11-22-19(23-14-6-3-5-13(21)10-14)24-18(17)16-9-8-12-4-1-2-7-15(12)16/h1-2,4,7,9,11,13-14H,3,5-6,8,10,21H2,(H,22,23,24)/t13?,14-/m1/s1 |
| InChIKey | RFCQKBVHNOKDKS-ARLHGKGLSA-N |
| XLogP | 3.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |