C22H23N7O4 — CID 44561582
2-(4-morpholin-4-ylanilino)-4-[(2-nitrophenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 44561582) has the molecular formula C22H23N7O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylanilino)-4-[(2-nitrophenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | 2-(4-morpholin-4-ylanilino)-4-[(2-nitrophenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 44561582 |
| Molecular Formula | C22H23N7O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-(4-morpholin-4-ylanilino)-4-[(2-nitrophenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCOCC3)cc2)nc1NCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23N7O4/c23-20(30)18-14-25-22(26-16-5-7-17(8-6-16)28-9-11-33-12-10-28)27-21(18)24-13-15-3-1-2-4-19(15)29(31)32/h1-8,14H,9-13H2,(H2,23,30)(H2,24,25,26,27) |
| InChIKey | JCDSUHIIORPINC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|