C21H19ClN7O2S- — CID 162715769
6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]-3-cyclopropyl-2H-indazole (PubChem CID 162715769) has the molecular formula C21H19ClN7O2S- and a molecular weight of 468.95 g/mol. Its IUPAC name is 6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]-3-cyclopropyl-2H-indazole.
| Compound Name | 6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]-3-cyclopropyl-2H-indazole |
|---|---|
| PubChem CID | 162715769 |
| Molecular Formula | C21H19ClN7O2S- |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]-3-cyclopropyl-2H-indazole |
| SMILES | O=S([O-])NCc1ccccc1Nc1nc(Nc2ccc3c(C4CC4)[nH]nc3c2)ncc1Cl |
| InChI | InChI=1S/C21H20ClN7O2S/c22-16-11-23-21(25-14-7-8-15-18(9-14)28-29-19(15)12-5-6-12)27-20(16)26-17-4-2-1-3-13(17)10-24-32(30)31/h1-4,7-9,11-12,24H,5-6,10H2,(H,28,29)(H,30,31)(H2,23,25,26,27)/p-1 |
| InChIKey | MWYMUUDQMURBSV-UHFFFAOYSA-M |
| XLogP | 4.25 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|