C18H15ClN7O2S- — CID 162715731
6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]imidazo[1,2-a]pyridine (PubChem CID 162715731) has the molecular formula C18H15ClN7O2S- and a molecular weight of 428.89 g/mol. Its IUPAC name is 6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]imidazo[1,2-a]pyridine.
| Compound Name | 6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 162715731 |
| Molecular Formula | C18H15ClN7O2S- |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 6-[[5-chloro-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidin-2-yl]amino]imidazo[1,2-a]pyridine |
| SMILES | O=S([O-])NCc1ccccc1Nc1nc(Nc2ccc3nccn3c2)ncc1Cl |
| InChI | InChI=1S/C18H16ClN7O2S/c19-14-10-21-18(23-13-5-6-16-20-7-8-26(16)11-13)25-17(14)24-15-4-2-1-3-12(15)9-22-29(27)28/h1-8,10-11,22H,9H2,(H,27,28)(H2,21,23,24,25)/p-1 |
| InChIKey | FCLQWMYLFNVBSA-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|