C25H30ClN7O — CID 58235913
1-[4-[[5-chloro-4-[2-(methylaminomethyl)anilino]pyrimidin-2-yl]amino]-3-methylphenyl]piperidine-4-carboxamide (PubChem CID 58235913) has the molecular formula C25H30ClN7O and a molecular weight of 480.02 g/mol. Its IUPAC name is 1-[4-[[5-chloro-4-[2-(methylaminomethyl)anilino]pyrimidin-2-yl]amino]-3-methylphenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[5-chloro-4-[2-(methylaminomethyl)anilino]pyrimidin-2-yl]amino]-3-methylphenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58235913 |
| Molecular Formula | C25H30ClN7O |
| Molecular Weight | 480.02 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 1-[4-[[5-chloro-4-[2-(methylaminomethyl)anilino]pyrimidin-2-yl]amino]-3-methylphenyl]piperidine-4-carboxamide |
| SMILES | CNCc1ccccc1Nc1nc(Nc2ccc(N3CCC(C(N)=O)CC3)cc2C)ncc1Cl |
| InChI | InChI=1S/C25H30ClN7O/c1-16-13-19(33-11-9-17(10-12-33)23(27)34)7-8-21(16)31-25-29-15-20(26)24(32-25)30-22-6-4-3-5-18(22)14-28-2/h3-8,13,15,17,28H,9-12,14H2,1-2H3,(H2,27,34)(H2,29,30,31,32) |
| InChIKey | PLUSWYOUVDJAJW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.02 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|