C25H28N6O — CID 147839754
1-N-ethyl-2-N-[2-[(4-morpholin-4-ylphenyl)methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]benzene-1,2-diamine (PubChem CID 147839754) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-N-ethyl-2-N-[2-[(4-morpholin-4-ylphenyl)methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]benzene-1,2-diamine.
| Compound Name | 1-N-ethyl-2-N-[2-[(4-morpholin-4-ylphenyl)methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 147839754 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-N-ethyl-2-N-[2-[(4-morpholin-4-ylphenyl)methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]benzene-1,2-diamine |
| SMILES | CCNc1ccccc1Nc1nc(Cc2ccc(N3CCOCC3)cc2)nc2cc[nH]c12 |
| InChI | InChI=1S/C25H28N6O/c1-2-26-20-5-3-4-6-21(20)29-25-24-22(11-12-27-24)28-23(30-25)17-18-7-9-19(10-8-18)31-13-15-32-16-14-31/h3-12,26-27H,2,13-17H2,1H3,(H,28,29,30) |
| InChIKey | HSSVXHNYCAMGED-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|