C28H33N5O2 — CID 166046517
11-cyclopentyl-5-methyl-2-[4-(2-propoxyethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one (PubChem CID 166046517) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 11-cyclopentyl-5-methyl-2-[4-(2-propoxyethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-cyclopentyl-5-methyl-2-[4-(2-propoxyethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 166046517 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 11-cyclopentyl-5-methyl-2-[4-(2-propoxyethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| SMILES | CCCOCCc1ccc(Nc2ncc3c(n2)N(C2CCCC2)c2ccccc2C(=O)N3C)cc1 |
| InChI | InChI=1S/C28H33N5O2/c1-3-17-35-18-16-20-12-14-21(15-13-20)30-28-29-19-25-26(31-28)33(22-8-4-5-9-22)24-11-7-6-10-23(24)27(34)32(25)2/h6-7,10-15,19,22H,3-5,8-9,16-18H2,1-2H3,(H,29,30,31) |
| InChIKey | ZXEQECBCCXCCTF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|