C21H21N5O2 — CID 147927899
1-[2-[[2-[(5-methoxy-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]phenyl]but-3-en-2-one (PubChem CID 147927899) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-[2-[[2-[(5-methoxy-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[2-[(5-methoxy-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 147927899 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-[2-[[2-[(5-methoxy-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccccc1Nc1nc(Nc2cncc(OC)c2)ncc1C |
| InChI | InChI=1S/C21H21N5O2/c1-4-17(27)9-15-7-5-6-8-19(15)25-20-14(2)11-23-21(26-20)24-16-10-18(28-3)13-22-12-16/h4-8,10-13H,1,9H2,2-3H3,(H2,23,24,25,26) |
| InChIKey | IJHCMGSAYIYBPO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|